C49H29N5S2 — CID 130263353
2-[4-[6-[3,5-di(dibenzothiophen-2-yl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]-1,3,5-triazine (PubChem CID 130263353) has the molecular formula C49H29N5S2 and a molecular weight of 751.94 g/mol. Its IUPAC name is 2-[4-[6-[3,5-di(dibenzothiophen-2-yl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2-[4-[6-[3,5-di(dibenzothiophen-2-yl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 130263353 |
| Molecular Formula | C49H29N5S2 |
| Molecular Weight | 751.94 g/mol |
| Exact Mass | 751.19 |
| IUPAC Name | 2-[4-[6-[3,5-di(dibenzothiophen-2-yl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4ncncn4)cc3)cc(-c3cc(-c4ccc5sc6ccccc6c5c4)cc(-c4ccc5sc6ccccc6c5c4)c3)n2)cc1 |
| InChI | InChI=1S/C49H29N5S2/c1-2-8-31(9-3-1)49-53-42(30-14-16-32(17-15-30)48-51-28-50-29-52-48)27-43(54-49)37-23-35(33-18-20-46-40(25-33)38-10-4-6-12-44(38)55-46)22-36(24-37)34-19-21-47-41(26-34)39-11-5-7-13-45(39)56-47/h1-29H |
| InChIKey | LOLKWMQWIMJEQM-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.94 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |