C37H30O2S — CID 130265476
8-[4-(benzenesulfonyl)phenyl]-14,14-diethylpentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),2,4,6,8,10,12,15,17,19-decaene (PubChem CID 130265476) has the molecular formula C37H30O2S and a molecular weight of 538.71 g/mol. Its IUPAC name is 8-[4-(benzenesulfonyl)phenyl]-14,14-diethylpentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),2,4,6,8,10,12,15,17,19-decaene.
| Compound Name | 8-[4-(benzenesulfonyl)phenyl]-14,14-diethylpentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),2,4,6,8,10,12,15,17,19-decaene |
|---|---|
| PubChem CID | 130265476 |
| Molecular Formula | C37H30O2S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 8-[4-(benzenesulfonyl)phenyl]-14,14-diethylpentacyclo[11.7.1.02,7.09,21.015,20]henicosa-1(21),2,4,6,8,10,12,15,17,19-decaene |
| SMILES | CCC1(CC)c2ccccc2-c2c3ccccc3c(-c3ccc(S(=O)(=O)c4ccccc4)cc3)c3cccc1c23 |
| InChI | InChI=1S/C37H30O2S/c1-3-37(4-2)32-19-11-10-17-30(32)35-29-16-9-8-15-28(29)34(31-18-12-20-33(37)36(31)35)25-21-23-27(24-22-25)40(38,39)26-13-6-5-7-14-26/h5-24H,3-4H2,1-2H3 |
| InChIKey | CGXYJUHPYGKLFX-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|