C38H56O — CID 130265978
(1R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19R)-3,7,12,16,19,20,20-heptamethyldocosa-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol (PubChem CID 130265978) has the molecular formula C38H56O and a molecular weight of 528.87 g/mol. Its IUPAC name is (1R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19R)-3,7,12,16,19,20,20-heptamethyldocosa-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol.
| Compound Name | (1R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19R)-3,7,12,16,19,20,20-heptamethyldocosa-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 130265978 |
| Molecular Formula | C38H56O |
| Molecular Weight | 528.87 g/mol |
| Exact Mass | 528.43 |
| IUPAC Name | (1R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19R)-3,7,12,16,19,20,20-heptamethyldocosa-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
| SMILES | CCC(C)(C)[C@H](C)/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C38H56O/c1-12-37(8,9)34(7)25-23-31(4)21-15-19-29(2)17-13-14-18-30(3)20-16-22-32(5)24-26-36-33(6)27-35(39)28-38(36,10)11/h13-26,34-35,39H,12,27-28H2,1-11H3/b14-13+,19-15+,20-16+,25-23+,26-24+,29-17+,30-18+,31-21+,32-22+/t34-,35-/m1/s1 |
| InChIKey | MTTAOBHCTKHLFM-PWAYWJHZSA-N |
| XLogP | 11.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.87 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|