C12H24N2O2 — CID 130266133
N-(2-amino-2-oxoethyl)-2,2,5,5-tetramethylhexanamide (PubChem CID 130266133) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2,2,5,5-tetramethylhexanamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2,2,5,5-tetramethylhexanamide |
|---|---|
| PubChem CID | 130266133 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2,2,5,5-tetramethylhexanamide |
| SMILES | CC(C)(C)CCC(C)(C)C(=O)NCC(N)=O |
| InChI | InChI=1S/C12H24N2O2/c1-11(2,3)6-7-12(4,5)10(16)14-8-9(13)15/h6-8H2,1-5H3,(H2,13,15)(H,14,16) |
| InChIKey | XVAALOOIYGLBSZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |