C16H31NO3S — CID 130266262
N-[(1,1-dioxothian-4-yl)methyl]-2,2,5,5-tetramethylhexanamide (PubChem CID 130266262) has the molecular formula C16H31NO3S and a molecular weight of 317.50 g/mol. Its IUPAC name is N-[(1,1-dioxothian-4-yl)methyl]-2,2,5,5-tetramethylhexanamide.
| Compound Name | N-[(1,1-dioxothian-4-yl)methyl]-2,2,5,5-tetramethylhexanamide |
|---|---|
| PubChem CID | 130266262 |
| Molecular Formula | C16H31NO3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | N-[(1,1-dioxothian-4-yl)methyl]-2,2,5,5-tetramethylhexanamide |
| SMILES | CC(C)(C)CCC(C)(C)C(=O)NCC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C16H31NO3S/c1-15(2,3)8-9-16(4,5)14(18)17-12-13-6-10-21(19,20)11-7-13/h13H,6-12H2,1-5H3,(H,17,18) |
| InChIKey | SZBUPYUMLKEEDG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |