C10H7F14NO — CID 130266390
1-(3-ethoxy-1,1,2,2-tetrafluoropropyl)-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine (PubChem CID 130266390) has the molecular formula C10H7F14NO and a molecular weight of 423.14 g/mol. Its IUPAC name is 1-(3-ethoxy-1,1,2,2-tetrafluoropropyl)-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine.
| Compound Name | 1-(3-ethoxy-1,1,2,2-tetrafluoropropyl)-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine |
|---|---|
| PubChem CID | 130266390 |
| Molecular Formula | C10H7F14NO |
| Molecular Weight | 423.14 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 1-(3-ethoxy-1,1,2,2-tetrafluoropropyl)-2,2,3,3,4,4,5,5,6,6-decafluoropiperidine |
| SMILES | CCOCC(F)(F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H7F14NO/c1-2-26-3-4(11,12)8(19,20)25-9(21,22)6(15,16)5(13,14)7(17,18)10(25,23)24/h2-3H2,1H3 |
| InChIKey | MBIPUVRPOXEABM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.14 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|