C7H4F11N — CID 130266402
2,2,3,4,5,6,6-heptafluoro-1-(fluoromethyl)-4-(trifluoromethyl)piperidine (PubChem CID 130266402) has the molecular formula C7H4F11N and a molecular weight of 311.09 g/mol. Its IUPAC name is 2,2,3,4,5,6,6-heptafluoro-1-(fluoromethyl)-4-(trifluoromethyl)piperidine.
| Compound Name | 2,2,3,4,5,6,6-heptafluoro-1-(fluoromethyl)-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 130266402 |
| Molecular Formula | C7H4F11N |
| Molecular Weight | 311.09 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 2,2,3,4,5,6,6-heptafluoro-1-(fluoromethyl)-4-(trifluoromethyl)piperidine |
| SMILES | FCN1C(F)(F)C(F)C(F)(C(F)(F)F)C(F)C1(F)F |
| InChI | InChI=1S/C7H4F11N/c8-1-19-5(12,13)2(9)4(11,7(16,17)18)3(10)6(19,14)15/h2-3H,1H2 |
| InChIKey | IXVCFSUGTNFWTL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.09 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|