C10H20F3N2O4S+ — CID 130266435
dimethyl-(3-sulfopropyl)-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium (PubChem CID 130266435) has the molecular formula C10H20F3N2O4S+ and a molecular weight of 321.34 g/mol. Its IUPAC name is dimethyl-(3-sulfopropyl)-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium.
| Compound Name | dimethyl-(3-sulfopropyl)-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 130266435 |
| Molecular Formula | C10H20F3N2O4S+ |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | dimethyl-(3-sulfopropyl)-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium |
| SMILES | C[N+](C)(CCCNC(=O)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C10H19F3N2O4S/c1-15(2,7-4-8-20(17,18)19)6-3-5-14-9(16)10(11,12)13/h3-8H2,1-2H3,(H-,14,16,17,18,19)/p+1 |
| InChIKey | OKTYMWXLOVFLDQ-UHFFFAOYSA-O |
| XLogP | 0.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|