C11H22F3N2O4S+ — CID 130266454
dimethyl-(4-sulfobutyl)-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium (PubChem CID 130266454) has the molecular formula C11H22F3N2O4S+ and a molecular weight of 335.37 g/mol. Its IUPAC name is dimethyl-(4-sulfobutyl)-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium.
| Compound Name | dimethyl-(4-sulfobutyl)-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 130266454 |
| Molecular Formula | C11H22F3N2O4S+ |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | dimethyl-(4-sulfobutyl)-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium |
| SMILES | C[N+](C)(CCCCS(=O)(=O)O)CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O4S/c1-16(2,7-3-4-9-21(18,19)20)8-5-6-15-10(17)11(12,13)14/h3-9H2,1-2H3,(H-,15,17,18,19,20)/p+1 |
| InChIKey | XDMKUUPTNGTMFX-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|