C8H4F13N — CID 130266501
2,2,3,3,5,5,6,6-octafluoro-1-(1,1,2,2,3-pentafluoropropyl)piperidine (PubChem CID 130266501) has the molecular formula C8H4F13N and a molecular weight of 361.10 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octafluoro-1-(1,1,2,2,3-pentafluoropropyl)piperidine.
| Compound Name | 2,2,3,3,5,5,6,6-octafluoro-1-(1,1,2,2,3-pentafluoropropyl)piperidine |
|---|---|
| PubChem CID | 130266501 |
| Molecular Formula | C8H4F13N |
| Molecular Weight | 361.10 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octafluoro-1-(1,1,2,2,3-pentafluoropropyl)piperidine |
| SMILES | FCC(F)(F)C(F)(F)N1C(F)(F)C(F)(F)CC(F)(F)C1(F)F |
| InChI | InChI=1S/C8H4F13N/c9-2-5(14,15)8(20,21)22-6(16,17)3(10,11)1-4(12,13)7(22,18)19/h1-2H2 |
| InChIKey | LPMQOVMQDQWZPZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.10 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|