C12H22F5N2O4S+ — CID 130266544
dimethyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]-(2-sulfobutyl)azanium (PubChem CID 130266544) has the molecular formula C12H22F5N2O4S+ and a molecular weight of 385.38 g/mol. Its IUPAC name is dimethyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]-(2-sulfobutyl)azanium.
| Compound Name | dimethyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]-(2-sulfobutyl)azanium |
|---|---|
| PubChem CID | 130266544 |
| Molecular Formula | C12H22F5N2O4S+ |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | dimethyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]-(2-sulfobutyl)azanium |
| SMILES | CCC(C[N+](C)(C)CCCNC(=O)C(F)(F)C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C12H21F5N2O4S/c1-4-9(24(21,22)23)8-19(2,3)7-5-6-18-10(20)11(13,14)12(15,16)17/h9H,4-8H2,1-3H3,(H-,18,20,21,22,23)/p+1 |
| InChIKey | FRLHPFSFGNIHPH-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|