C6H8F5NO4S — CID 130266586
2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]ethanesulfonic acid (PubChem CID 130266586) has the molecular formula C6H8F5NO4S and a molecular weight of 285.19 g/mol. Its IUPAC name is 2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]ethanesulfonic acid.
| Compound Name | 2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 130266586 |
| Molecular Formula | C6H8F5NO4S |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]ethanesulfonic acid |
| SMILES | CN(CCS(=O)(=O)O)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F5NO4S/c1-12(2-3-17(14,15)16)4(13)5(7,8)6(9,10)11/h2-3H2,1H3,(H,14,15,16) |
| InChIKey | FDKFHVJCNMXVEK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|