C7H13F5N2O3S — CID 130266611
N,N-dimethyl-3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propan-1-amine oxide (PubChem CID 130266611) has the molecular formula C7H13F5N2O3S and a molecular weight of 300.25 g/mol. Its IUPAC name is N,N-dimethyl-3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propan-1-amine oxide.
| Compound Name | N,N-dimethyl-3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propan-1-amine oxide |
|---|---|
| PubChem CID | 130266611 |
| Molecular Formula | C7H13F5N2O3S |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N,N-dimethyl-3-(1,1,2,2,2-pentafluoroethylsulfonylamino)propan-1-amine oxide |
| SMILES | C[N+](C)([O-])CCCNS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H13F5N2O3S/c1-14(2,15)5-3-4-13-18(16,17)7(11,12)6(8,9)10/h13H,3-5H2,1-2H3 |
| InChIKey | CZTSZHRIAHHYHN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|