C10H16F5N2O3+ — CID 130266740
carboxymethyl-dimethyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]azanium (PubChem CID 130266740) has the molecular formula C10H16F5N2O3+ and a molecular weight of 307.24 g/mol. Its IUPAC name is carboxymethyl-dimethyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]azanium.
| Compound Name | carboxymethyl-dimethyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]azanium |
|---|---|
| PubChem CID | 130266740 |
| Molecular Formula | C10H16F5N2O3+ |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | carboxymethyl-dimethyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]azanium |
| SMILES | C[N+](C)(CCCNC(=O)C(F)(F)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C10H15F5N2O3/c1-17(2,6-7(18)19)5-3-4-16-8(20)9(11,12)10(13,14)15/h3-6H2,1-2H3,(H-,16,18,19,20)/p+1 |
| InChIKey | MNWPJWJYLZNXEX-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|