C9H15F5NO5S+ — CID 130266788
carboxymethyl-dimethyl-[2-(1,1,2,2,3-pentafluoropropylsulfonyloxy)ethyl]azanium (PubChem CID 130266788) has the molecular formula C9H15F5NO5S+ and a molecular weight of 344.28 g/mol. Its IUPAC name is carboxymethyl-dimethyl-[2-(1,1,2,2,3-pentafluoropropylsulfonyloxy)ethyl]azanium.
| Compound Name | carboxymethyl-dimethyl-[2-(1,1,2,2,3-pentafluoropropylsulfonyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 130266788 |
| Molecular Formula | C9H15F5NO5S+ |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | carboxymethyl-dimethyl-[2-(1,1,2,2,3-pentafluoropropylsulfonyloxy)ethyl]azanium |
| SMILES | C[N+](C)(CCOS(=O)(=O)C(F)(F)C(F)(F)CF)CC(=O)O |
| InChI | InChI=1S/C9H14F5NO5S/c1-15(2,5-7(16)17)3-4-20-21(18,19)9(13,14)8(11,12)6-10/h3-6H2,1-2H3/p+1 |
| InChIKey | ZXOMWDMDQJTEDP-UHFFFAOYSA-O |
| XLogP | 0.69 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|