C8H16F3N2O4S+ — CID 130266835
dimethyl-(sulfomethyl)-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium (PubChem CID 130266835) has the molecular formula C8H16F3N2O4S+ and a molecular weight of 293.29 g/mol. Its IUPAC name is dimethyl-(sulfomethyl)-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium.
| Compound Name | dimethyl-(sulfomethyl)-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 130266835 |
| Molecular Formula | C8H16F3N2O4S+ |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | dimethyl-(sulfomethyl)-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium |
| SMILES | C[N+](C)(CCCNC(=O)C(F)(F)F)CS(=O)(=O)O |
| InChI | InChI=1S/C8H15F3N2O4S/c1-13(2,6-18(15,16)17)5-3-4-12-7(14)8(9,10)11/h3-6H2,1-2H3,(H-,12,14,15,16,17)/p+1 |
| InChIKey | LPFVFZNLLAGBJR-UHFFFAOYSA-O |
| XLogP | -0.02 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|