C18H8N6OS2 — CID 130267539
2-([1,3]thiazolo[4,5-b]pyridin-6-yl)-6-([1,3]thiazolo[5,4-b]pyridin-2-yl)-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 130267539) has the molecular formula C18H8N6OS2 and a molecular weight of 388.44 g/mol. Its IUPAC name is 2-([1,3]thiazolo[4,5-b]pyridin-6-yl)-6-([1,3]thiazolo[5,4-b]pyridin-2-yl)-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 2-([1,3]thiazolo[4,5-b]pyridin-6-yl)-6-([1,3]thiazolo[5,4-b]pyridin-2-yl)-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 130267539 |
| Molecular Formula | C18H8N6OS2 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 2-([1,3]thiazolo[4,5-b]pyridin-6-yl)-6-([1,3]thiazolo[5,4-b]pyridin-2-yl)-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | c1cnc2sc(-c3cnc4nc(-c5cnc6ncsc6c5)oc4c3)nc2c1 |
| InChI | InChI=1S/C18H8N6OS2/c1-2-11-18(19-3-1)27-17(23-11)10-4-12-14(20-7-10)24-16(25-12)9-5-13-15(21-6-9)22-8-26-13/h1-8H |
| InChIKey | BVYVYSICVSLCBO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |