About 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine
2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine (PubChem CID 130267718) has the molecular formula C11H25N3S
and a molecular weight of 231.41 g/mol. Its IUPAC name is 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine.
Molecular Properties
| Compound Name | 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine |
| PubChem CID | 130267718 |
| Molecular Formula | C11H25N3S |
| Molecular Weight | 231.41 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine |
| SMILES | CNC(C)CC(C)N(C)SN1CCCC1 |
| InChI | InChI=1S/C11H25N3S/c1-10(12-3)9-11(2)13(4)15-14-7-5-6-8-14/h10-12H,5-9H2,1-4H3 |
| InChIKey | IAJITQHHVXFVQJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine?
The IUPAC name of 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine (CID 130267718) is 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine.
What is the SMILES notation for 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine?
The canonical SMILES for 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine is CNC(C)CC(C)N(C)SN1CCCC1.
What is the InChIKey of 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine?
The InChIKey is IAJITQHHVXFVQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3S/c1-10(12-3)9-11(2)13(4)15-14-7-5-6-8-14/h10-12H,5-9H2,1-4H3.
What are the key properties of 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine?
2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine has a molecular weight of 231.41 g/mol, XLogP of 1.96, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,4-N-dimethyl-4-N-pyrrolidin-1-ylsulfanylpentane-2,4-diamine is sourced from PubChem (CID 130267718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).