About 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine
7-propan-2-ylimidazo[2,1-c][1,2,4]triazine (PubChem CID 130267893) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine.
Molecular Properties
| Compound Name | 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine |
| PubChem CID | 130267893 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine |
| SMILES | CC(C)c1cn2ccnnc2n1 |
| InChI | InChI=1S/C8H10N4/c1-6(2)7-5-12-4-3-9-11-8(12)10-7/h3-6H,1-2H3 |
| InChIKey | AIQMYJKEUYQIMY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine?
The IUPAC name of 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine (CID 130267893) is 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine.
What is the SMILES notation for 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine?
The canonical SMILES for 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine is CC(C)c1cn2ccnnc2n1.
What is the InChIKey of 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine?
The InChIKey is AIQMYJKEUYQIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-6(2)7-5-12-4-3-9-11-8(12)10-7/h3-6H,1-2H3.
What are the key properties of 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine?
7-propan-2-ylimidazo[2,1-c][1,2,4]triazine has a molecular weight of 162.20 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-ylimidazo[2,1-c][1,2,4]triazine is sourced from PubChem (CID 130267893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).