About 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole
3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole (PubChem CID 130268133) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole.
Molecular Properties
| Compound Name | 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole |
| PubChem CID | 130268133 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole |
| SMILES | C/C=C\C=C/C1=CC(C)N=N1 |
| InChI | InChI=1S/C9H12N2/c1-3-4-5-6-9-7-8(2)10-11-9/h3-8H,1-2H3/b4-3-,6-5- |
| InChIKey | VLHHRIHGSLAVHL-OUPQRBNQSA-N |
| XLogP | 2.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole?
The IUPAC name of 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole (CID 130268133) is 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole.
What is the SMILES notation for 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole?
The canonical SMILES for 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole is C/C=C\C=C/C1=CC(C)N=N1.
What is the InChIKey of 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole?
The InChIKey is VLHHRIHGSLAVHL-OUPQRBNQSA-N. The full InChI is InChI=1S/C9H12N2/c1-3-4-5-6-9-7-8(2)10-11-9/h3-8H,1-2H3/b4-3-,6-5-.
What are the key properties of 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole?
3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole has a molecular weight of 148.21 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-[(1Z,3Z)-penta-1,3-dienyl]-3H-pyrazole is sourced from PubChem (CID 130268133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).