About (9R)-9-fluorotricyclo[5.3.0.02,5]decane
(9R)-9-fluorotricyclo[5.3.0.02,5]decane (PubChem CID 130269175) has the molecular formula C10H15F
and a molecular weight of 154.23 g/mol. Its IUPAC name is (9R)-9-fluorotricyclo[5.3.0.02,5]decane.
Molecular Properties
| Compound Name | (9R)-9-fluorotricyclo[5.3.0.02,5]decane |
| PubChem CID | 130269175 |
| Molecular Formula | C10H15F |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | (9R)-9-fluorotricyclo[5.3.0.02,5]decane |
| SMILES | F[C@@H]1CC2CC3CCC3C2C1 |
| InChI | InChI=1S/C10H15F/c11-8-4-7-3-6-1-2-9(6)10(7)5-8/h6-10H,1-5H2/t6?,7?,8-,9?,10?/m1/s1 |
| InChIKey | KINHDQAXUWYJEP-GYWDWBNWSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (9R)-9-fluorotricyclo[5.3.0.02,5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9R)-9-fluorotricyclo[5.3.0.02,5]decane?
The IUPAC name of (9R)-9-fluorotricyclo[5.3.0.02,5]decane (CID 130269175) is (9R)-9-fluorotricyclo[5.3.0.02,5]decane.
What is the SMILES notation for (9R)-9-fluorotricyclo[5.3.0.02,5]decane?
The canonical SMILES for (9R)-9-fluorotricyclo[5.3.0.02,5]decane is F[C@@H]1CC2CC3CCC3C2C1.
What is the InChIKey of (9R)-9-fluorotricyclo[5.3.0.02,5]decane?
The InChIKey is KINHDQAXUWYJEP-GYWDWBNWSA-N. The full InChI is InChI=1S/C10H15F/c11-8-4-7-3-6-1-2-9(6)10(7)5-8/h6-10H,1-5H2/t6?,7?,8-,9?,10?/m1/s1.
What are the key properties of (9R)-9-fluorotricyclo[5.3.0.02,5]decane?
(9R)-9-fluorotricyclo[5.3.0.02,5]decane has a molecular weight of 154.23 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (9R)-9-fluorotricyclo[5.3.0.02,5]decane is sourced from PubChem (CID 130269175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).