About 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide
1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide (PubChem CID 130269307) has the molecular formula C21H28N2O
and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide.
Molecular Properties
| Compound Name | 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide |
| PubChem CID | 130269307 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide |
| SMILES | O=C(NC1CCNCC1)C12CC3CC1CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C21H28N2O/c24-19(23-18-6-8-22-9-7-18)21-12-15-10-17(21)13-20(11-15,14-21)16-4-2-1-3-5-16/h1-5,15,17-18,22H,6-14H2,(H,23,24) |
| InChIKey | YVWGASPMGNDMNW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide?
The IUPAC name of 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide (CID 130269307) is 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide.
What is the SMILES notation for 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide?
The canonical SMILES for 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide is O=C(NC1CCNCC1)C12CC3CC1CC(c1ccccc1)(C3)C2.
What is the InChIKey of 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide?
The InChIKey is YVWGASPMGNDMNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O/c24-19(23-18-6-8-22-9-7-18)21-12-15-10-17(21)13-20(11-15,14-21)16-4-2-1-3-5-16/h1-5,15,17-18,22H,6-14H2,(H,23,24).
What are the key properties of 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide?
1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide has a molecular weight of 324.47 g/mol, XLogP of 3.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N-piperidin-4-yltricyclo[3.3.1.03,7]nonane-3-carboxamide is sourced from PubChem (CID 130269307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).