About 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one
3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one (PubChem CID 130269387) has the molecular formula C14H24N4O
and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one.
Molecular Properties
| Compound Name | 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one |
| PubChem CID | 130269387 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one |
| SMILES | Cc1cc(N)c(=O)n(CCN2CC(C)NC(C)C2)c1 |
| InChI | InChI=1S/C14H24N4O/c1-10-6-13(15)14(19)18(7-10)5-4-17-8-11(2)16-12(3)9-17/h6-7,11-12,16H,4-5,8-9,15H2,1-3H3 |
| InChIKey | IEEJBJBJBXEYCJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one?
The IUPAC name of 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one (CID 130269387) is 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one.
What is the SMILES notation for 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one?
The canonical SMILES for 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one is Cc1cc(N)c(=O)n(CCN2CC(C)NC(C)C2)c1.
What is the InChIKey of 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one?
The InChIKey is IEEJBJBJBXEYCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O/c1-10-6-13(15)14(19)18(7-10)5-4-17-8-11(2)16-12(3)9-17/h6-7,11-12,16H,4-5,8-9,15H2,1-3H3.
What are the key properties of 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one?
3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one has a molecular weight of 264.37 g/mol, XLogP of 0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-[2-(3,5-dimethylpiperazin-1-yl)ethyl]-5-methylpyridin-2-one is sourced from PubChem (CID 130269387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).