C33H33N3O7 — CID 130269606
(E)-3-(3,4,5-trimethoxyphenyl)-N-[[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide (PubChem CID 130269606) has the molecular formula C33H33N3O7 and a molecular weight of 583.64 g/mol. Its IUPAC name is (E)-3-(3,4,5-trimethoxyphenyl)-N-[[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4,5-trimethoxyphenyl)-N-[[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 130269606 |
| Molecular Formula | C33H33N3O7 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | (E)-3-(3,4,5-trimethoxyphenyl)-N-[[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCc2cc3c([nH]c4ccccc43)c(-c3cc(OC)c(OC)c(OC)c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C33H33N3O7/c1-38-25-13-19(14-26(39-2)32(25)42-5)11-12-29(37)34-18-21-17-23-22-9-7-8-10-24(22)36-31(23)30(35-21)20-15-27(40-3)33(43-6)28(16-20)41-4/h7-17,36H,18H2,1-6H3,(H,34,37)/b12-11+ |
| InChIKey | HZOGQPCHBYMRFM-VAWYXSNFSA-N |
| XLogP | 5.76 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|