About 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide
3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide (PubChem CID 130270074) has the molecular formula C20H20N2O3
and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide.
Molecular Properties
| Compound Name | 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide |
| PubChem CID | 130270074 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide |
| SMILES | CN1CC[C@@](O)(C#Cc2cccc(-c3cccc(C(N)=O)c3)c2)C1O |
| InChI | InChI=1S/C20H20N2O3/c1-22-11-10-20(25,19(22)24)9-8-14-4-2-5-15(12-14)16-6-3-7-17(13-16)18(21)23/h2-7,12-13,19,24-25H,10-11H2,1H3,(H2,21,23)/t19?,20-/m0/s1 |
| InChIKey | AQBZPSMCLNHUBY-ANYOKISRSA-N |
| XLogP | 1.19 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide?
The IUPAC name of 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide (CID 130270074) is 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide.
What is the SMILES notation for 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide?
The canonical SMILES for 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide is CN1CC[C@@](O)(C#Cc2cccc(-c3cccc(C(N)=O)c3)c2)C1O.
What is the InChIKey of 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide?
The InChIKey is AQBZPSMCLNHUBY-ANYOKISRSA-N. The full InChI is InChI=1S/C20H20N2O3/c1-22-11-10-20(25,19(22)24)9-8-14-4-2-5-15(12-14)16-6-3-7-17(13-16)18(21)23/h2-7,12-13,19,24-25H,10-11H2,1H3,(H2,21,23)/t19?,20-/m0/s1.
What are the key properties of 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide?
3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide has a molecular weight of 336.39 g/mol, XLogP of 1.19, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[2-[(3R)-2,3-dihydroxy-1-methylpyrrolidin-3-yl]ethynyl]phenyl]benzamide is sourced from PubChem (CID 130270074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).