About 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan
2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan (PubChem CID 130271189) has the molecular formula C15H16O3
and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan.
Molecular Properties
| Compound Name | 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan |
| PubChem CID | 130271189 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan |
| SMILES | C=C/C=C(\OC)c1ccc(/C(=C/C=C)OC=C)o1 |
| InChI | InChI=1S/C15H16O3/c1-5-8-12(16-4)14-10-11-15(18-14)13(9-6-2)17-7-3/h5-11H,1-3H2,4H3/b12-8-,13-9- |
| InChIKey | TTYRFZGKMFSAEK-JMVBYTIWSA-N |
| XLogP | 4.14 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan?
The IUPAC name of 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan (CID 130271189) is 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan.
What is the SMILES notation for 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan?
The canonical SMILES for 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan is C=C/C=C(\OC)c1ccc(/C(=C/C=C)OC=C)o1.
What is the InChIKey of 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan?
The InChIKey is TTYRFZGKMFSAEK-JMVBYTIWSA-N. The full InChI is InChI=1S/C15H16O3/c1-5-8-12(16-4)14-10-11-15(18-14)13(9-6-2)17-7-3/h5-11H,1-3H2,4H3/b12-8-,13-9-.
What are the key properties of 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan?
2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan has a molecular weight of 244.29 g/mol, XLogP of 4.14, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1Z)-1-ethenoxybuta-1,3-dienyl]-5-[(1Z)-1-methoxybuta-1,3-dienyl]furan is sourced from PubChem (CID 130271189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).