About 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one
2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one (PubChem CID 130271377) has the molecular formula C17H30N2O
and a molecular weight of 278.44 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one |
| PubChem CID | 130271377 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one |
| SMILES | CC(C)(C)Cc1cc(C(C)(C)C)c(=O)n(C(C)(C)C)n1 |
| InChI | InChI=1S/C17H30N2O/c1-15(2,3)11-12-10-13(16(4,5)6)14(20)19(18-12)17(7,8)9/h10H,11H2,1-9H3 |
| InChIKey | IDZCIJAAMRDZRL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one?
The IUPAC name of 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one (CID 130271377) is 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one.
What is the SMILES notation for 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one?
The canonical SMILES for 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one is CC(C)(C)Cc1cc(C(C)(C)C)c(=O)n(C(C)(C)C)n1.
What is the InChIKey of 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one?
The InChIKey is IDZCIJAAMRDZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O/c1-15(2,3)11-12-10-13(16(4,5)6)14(20)19(18-12)17(7,8)9/h10H,11H2,1-9H3.
What are the key properties of 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one?
2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one has a molecular weight of 278.44 g/mol, XLogP of 3.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-6-(2,2-dimethylpropyl)pyridazin-3-one is sourced from PubChem (CID 130271377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).