About (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran
(8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran (PubChem CID 130271398) has the molecular formula C20H30O
and a molecular weight of 286.46 g/mol. Its IUPAC name is (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran.
Molecular Properties
| Compound Name | (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran |
| PubChem CID | 130271398 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran |
| SMILES | CC(C)[C@]1(C)C=CC=C2C(=C1)OC(C)(C)C=C2C(C)(C)C |
| InChI | InChI=1S/C20H30O/c1-14(2)20(8)11-9-10-15-16(18(3,4)5)12-19(6,7)21-17(15)13-20/h9-14H,1-8H3/t20-/m1/s1 |
| InChIKey | COIWQKYOHRVELD-HXUWFJFHSA-N |
| XLogP | 5.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran?
The IUPAC name of (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran (CID 130271398) is (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran.
What is the SMILES notation for (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran?
The canonical SMILES for (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran is CC(C)[C@]1(C)C=CC=C2C(=C1)OC(C)(C)C=C2C(C)(C)C.
What is the InChIKey of (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran?
The InChIKey is COIWQKYOHRVELD-HXUWFJFHSA-N. The full InChI is InChI=1S/C20H30O/c1-14(2)20(8)11-9-10-15-16(18(3,4)5)12-19(6,7)21-17(15)13-20/h9-14H,1-8H3/t20-/m1/s1.
What are the key properties of (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran?
(8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran has a molecular weight of 286.46 g/mol, XLogP of 5.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-4-tert-butyl-2,2,8-trimethyl-8-propan-2-ylcyclohepta[b]pyran is sourced from PubChem (CID 130271398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).