C19H31NO4 — CID 130271499
tert-butyl (3R,4S)-3-(hydroxymethyl)-4-[(3Z,5E)-6-methoxyhepta-1,3,5-trien-2-yl]piperidine-1-carboxylate (PubChem CID 130271499) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-(hydroxymethyl)-4-[(3Z,5E)-6-methoxyhepta-1,3,5-trien-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-(hydroxymethyl)-4-[(3Z,5E)-6-methoxyhepta-1,3,5-trien-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 130271499 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | tert-butyl (3R,4S)-3-(hydroxymethyl)-4-[(3Z,5E)-6-methoxyhepta-1,3,5-trien-2-yl]piperidine-1-carboxylate |
| SMILES | C=C(/C=C\C=C(/C)OC)[C@H]1CCN(C(=O)OC(C)(C)C)C[C@@H]1CO |
| InChI | InChI=1S/C19H31NO4/c1-14(8-7-9-15(2)23-6)17-10-11-20(12-16(17)13-21)18(22)24-19(3,4)5/h7-9,16-17,21H,1,10-13H2,2-6H3/b8-7-,15-9+/t16-,17-/m1/s1 |
| InChIKey | QWFNNLLLHFEVKK-IBTIOBPMSA-N |
| XLogP | 3.51 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|