C9H11N3 — CID 13027172
2,4-dimethyl-5,8-dihydropyrido[2,3-d]pyrimidine (PubChem CID 13027172) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 2,4-dimethyl-5,8-dihydropyrido[2,3-d]pyrimidine.
| Compound Name | 2,4-dimethyl-5,8-dihydropyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 13027172 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 2,4-dimethyl-5,8-dihydropyrido[2,3-d]pyrimidine |
| SMILES | Cc1nc(C)c2c(n1)NC=CC2 |
| InChI | InChI=1S/C9H11N3/c1-6-8-4-3-5-10-9(8)12-7(2)11-6/h3,5H,4H2,1-2H3,(H,10,11,12) |
| InChIKey | CONXGXKXLWJLIM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |