C13H21N — CID 130272002
N-[(3Z,5E)-hepta-1,3,5-trien-4-yl]-3,3-dimethylbutan-2-imine (PubChem CID 130272002) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is N-[(3Z,5E)-hepta-1,3,5-trien-4-yl]-3,3-dimethylbutan-2-imine.
| Compound Name | N-[(3Z,5E)-hepta-1,3,5-trien-4-yl]-3,3-dimethylbutan-2-imine |
|---|---|
| PubChem CID | 130272002 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N-[(3Z,5E)-hepta-1,3,5-trien-4-yl]-3,3-dimethylbutan-2-imine |
| SMILES | C=C/C=C(/C=C/C)\N=C(/C)C(C)(C)C |
| InChI | InChI=1S/C13H21N/c1-7-9-12(10-8-2)14-11(3)13(4,5)6/h7-10H,1H2,2-6H3/b10-8+,12-9-,14-11+ |
| InChIKey | JPOUNYICBZNOSA-XGUJXIEKSA-N |
| XLogP | 4.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|