C17H31N — CID 130272070
(2Z,5Z)-3-tert-butyl-N,9,9-trimethyldeca-2,5-dien-4-imine (PubChem CID 130272070) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is (2Z,5Z)-3-tert-butyl-N,9,9-trimethyldeca-2,5-dien-4-imine.
| Compound Name | (2Z,5Z)-3-tert-butyl-N,9,9-trimethyldeca-2,5-dien-4-imine |
|---|---|
| PubChem CID | 130272070 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | (2Z,5Z)-3-tert-butyl-N,9,9-trimethyldeca-2,5-dien-4-imine |
| SMILES | C/C=C(C(\C=C/CCC(C)(C)C)=N\C)/C(C)(C)C |
| InChI | InChI=1S/C17H31N/c1-9-14(17(5,6)7)15(18-8)12-10-11-13-16(2,3)4/h9-10,12H,11,13H2,1-8H3/b12-10-,14-9+,18-15+ |
| InChIKey | IUNJHTGZNQDQLQ-QKFLSIHUSA-N |
| XLogP | 5.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|