About N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide
N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide (PubChem CID 130272131) has the molecular formula C14H27NO3S
and a molecular weight of 289.44 g/mol. Its IUPAC name is N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide.
Molecular Properties
| Compound Name | N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide |
| PubChem CID | 130272131 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide |
| SMILES | CC(C)(C)CCCC(=O)NCC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H27NO3S/c1-14(2,3)8-4-5-13(16)15-11-12-6-9-19(17,18)10-7-12/h12H,4-11H2,1-3H3,(H,15,16) |
| InChIKey | UUNTUOUBPWOYAK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide?
The IUPAC name of N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide (CID 130272131) is N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide.
What is the SMILES notation for N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide?
The canonical SMILES for N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide is CC(C)(C)CCCC(=O)NCC1CCS(=O)(=O)CC1.
What is the InChIKey of N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide?
The InChIKey is UUNTUOUBPWOYAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3S/c1-14(2,3)8-4-5-13(16)15-11-12-6-9-19(17,18)10-7-12/h12H,4-11H2,1-3H3,(H,15,16).
What are the key properties of N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide?
N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide has a molecular weight of 289.44 g/mol, XLogP of 2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylhexanamide is sourced from PubChem (CID 130272131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).