C12H25NO2 — CID 130272176
N-(2-methoxyethyl)-2,2,4,4-tetramethylpentanamide (PubChem CID 130272176) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2,2,4,4-tetramethylpentanamide.
| Compound Name | N-(2-methoxyethyl)-2,2,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 130272176 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | N-(2-methoxyethyl)-2,2,4,4-tetramethylpentanamide |
| SMILES | COCCNC(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C12H25NO2/c1-11(2,3)9-12(4,5)10(14)13-7-8-15-6/h7-9H2,1-6H3,(H,13,14) |
| InChIKey | CMLFMTFJSYDEQC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|