C15H29NO3S — CID 130272266
N-(1,1-dioxothian-4-yl)-2,2,4,4-tetramethylhexanamide (PubChem CID 130272266) has the molecular formula C15H29NO3S and a molecular weight of 303.47 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-2,2,4,4-tetramethylhexanamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-2,2,4,4-tetramethylhexanamide |
|---|---|
| PubChem CID | 130272266 |
| Molecular Formula | C15H29NO3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-2,2,4,4-tetramethylhexanamide |
| SMILES | CCC(C)(C)CC(C)(C)C(=O)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H29NO3S/c1-6-14(2,3)11-15(4,5)13(17)16-12-7-9-20(18,19)10-8-12/h12H,6-11H2,1-5H3,(H,16,17) |
| InChIKey | DQFYQBCUQIAJDB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |