C13H26N2O2 — CID 130272292
2,2,5,5-tetramethyl-N-[2-(methylamino)-2-oxoethyl]hexanamide (PubChem CID 130272292) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-[2-(methylamino)-2-oxoethyl]hexanamide.
| Compound Name | 2,2,5,5-tetramethyl-N-[2-(methylamino)-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 130272292 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-[2-(methylamino)-2-oxoethyl]hexanamide |
| SMILES | CNC(=O)CNC(=O)C(C)(C)CCC(C)(C)C |
| InChI | InChI=1S/C13H26N2O2/c1-12(2,3)7-8-13(4,5)11(17)15-9-10(16)14-6/h7-9H2,1-6H3,(H,14,16)(H,15,17) |
| InChIKey | LPDJJKHDGUPBAE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |