About pyrrolidine-3,4-dione
pyrrolidine-3,4-dione (PubChem CID 13027232) has the molecular formula C4H5NO2
and a molecular weight of 99.09 g/mol. Its IUPAC name is pyrrolidine-3,4-dione.
Molecular Properties
| Compound Name | pyrrolidine-3,4-dione |
| PubChem CID | 13027232 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | pyrrolidine-3,4-dione |
| SMILES | O=C1CNCC1=O |
| InChI | InChI=1S/C4H5NO2/c6-3-1-5-2-4(3)7/h5H,1-2H2 |
| InChIKey | BHDAVTMCXVRKAS-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidine-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-3,4-dione?
The IUPAC name of pyrrolidine-3,4-dione (CID 13027232) is pyrrolidine-3,4-dione.
What is the SMILES notation for pyrrolidine-3,4-dione?
The canonical SMILES for pyrrolidine-3,4-dione is O=C1CNCC1=O.
What is the InChIKey of pyrrolidine-3,4-dione?
The InChIKey is BHDAVTMCXVRKAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2/c6-3-1-5-2-4(3)7/h5H,1-2H2.
What are the key properties of pyrrolidine-3,4-dione?
pyrrolidine-3,4-dione has a molecular weight of 99.09 g/mol, XLogP of -1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-3,4-dione is sourced from PubChem (CID 13027232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).