About N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide
N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide (PubChem CID 130272357) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 130272357 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cnoc1C(=O)NCCCC(C)(C)C |
| InChI | InChI=1S/C12H20N2O2/c1-9-8-14-16-10(9)11(15)13-7-5-6-12(2,3)4/h8H,5-7H2,1-4H3,(H,13,15) |
| InChIKey | CPRKULNGPQFQPP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide?
The IUPAC name of N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide (CID 130272357) is N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide is Cc1cnoc1C(=O)NCCCC(C)(C)C.
What is the InChIKey of N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide?
The InChIKey is CPRKULNGPQFQPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-9-8-14-16-10(9)11(15)13-7-5-6-12(2,3)4/h8H,5-7H2,1-4H3,(H,13,15).
What are the key properties of N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide?
N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide has a molecular weight of 224.30 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylpentyl)-4-methyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 130272357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).