About N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide
N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide (PubChem CID 130272383) has the molecular formula C15H29NO3S
and a molecular weight of 303.47 g/mol. Its IUPAC name is N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide.
Molecular Properties
| Compound Name | N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide |
| PubChem CID | 130272383 |
| Molecular Formula | C15H29NO3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide |
| SMILES | CCC(C)(C)CCCC(=O)NCC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H29NO3S/c1-4-15(2,3)9-5-6-14(17)16-12-13-7-10-20(18,19)11-8-13/h13H,4-12H2,1-3H3,(H,16,17) |
| InChIKey | YHAIKXYAEPZJAT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide?
The IUPAC name of N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide (CID 130272383) is N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide.
What is the SMILES notation for N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide?
The canonical SMILES for N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide is CCC(C)(C)CCCC(=O)NCC1CCS(=O)(=O)CC1.
What is the InChIKey of N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide?
The InChIKey is YHAIKXYAEPZJAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO3S/c1-4-15(2,3)9-5-6-14(17)16-12-13-7-10-20(18,19)11-8-13/h13H,4-12H2,1-3H3,(H,16,17).
What are the key properties of N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide?
N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide has a molecular weight of 303.47 g/mol, XLogP of 2.53, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,1-dioxothian-4-yl)methyl]-5,5-dimethylheptanamide is sourced from PubChem (CID 130272383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).