About N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide
N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide (PubChem CID 130272401) has the molecular formula C13H25NO3S
and a molecular weight of 275.41 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide.
Molecular Properties
| Compound Name | N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide |
| PubChem CID | 130272401 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide |
| SMILES | CCCC(C)(C)CC(=O)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H25NO3S/c1-4-7-13(2,3)10-12(15)14-11-5-8-18(16,17)9-6-11/h11H,4-10H2,1-3H3,(H,14,15) |
| InChIKey | ZJSVWCXYOGBBOA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide?
The IUPAC name of N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide (CID 130272401) is N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide.
What is the SMILES notation for N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide?
The canonical SMILES for N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide is CCCC(C)(C)CC(=O)NC1CCS(=O)(=O)CC1.
What is the InChIKey of N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide?
The InChIKey is ZJSVWCXYOGBBOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3S/c1-4-7-13(2,3)10-12(15)14-11-5-8-18(16,17)9-6-11/h11H,4-10H2,1-3H3,(H,14,15).
What are the key properties of N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide?
N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide has a molecular weight of 275.41 g/mol, XLogP of 1.90, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothian-4-yl)-3,3-dimethylhexanamide is sourced from PubChem (CID 130272401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).