C24H26FN5O3 — CID 130272472
1-[5-fluoro-7-[(2Z)-2-prop-1-en-2-yloxyiminopropyl]-11-pyridin-3-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-2-yl]pyrrolidin-3-ol (PubChem CID 130272472) has the molecular formula C24H26FN5O3 and a molecular weight of 451.50 g/mol. Its IUPAC name is 1-[5-fluoro-7-[(2Z)-2-prop-1-en-2-yloxyiminopropyl]-11-pyridin-3-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-2-yl]pyrrolidin-3-ol.
| Compound Name | 1-[5-fluoro-7-[(2Z)-2-prop-1-en-2-yloxyiminopropyl]-11-pyridin-3-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-2-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 130272472 |
| Molecular Formula | C24H26FN5O3 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 1-[5-fluoro-7-[(2Z)-2-prop-1-en-2-yloxyiminopropyl]-11-pyridin-3-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-2-yl]pyrrolidin-3-ol |
| SMILES | C=C(C)O/N=C(/C)Cc1cc(F)c2nc(N3CCC(O)C3)n3c2c1OCC3c1cccnc1 |
| InChI | InChI=1S/C24H26FN5O3/c1-14(2)33-28-15(3)9-17-10-19(25)21-22-23(17)32-13-20(16-5-4-7-26-11-16)30(22)24(27-21)29-8-6-18(31)12-29/h4-5,7,10-11,18,20,31H,1,6,8-9,12-13H2,2-3H3/b28-15- |
| InChIKey | CYKIBGCZZJDPEX-MBTHVWNTSA-N |
| XLogP | 3.59 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|