C22H24F3N5O — CID 130272521
3-[(3R)-3-(cyclopropen-1-yl)-4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]-1-cyclopropyl-5,6,7,8-tetrahydro-2,7-naphthyridine-4-carbonitrile (PubChem CID 130272521) has the molecular formula C22H24F3N5O and a molecular weight of 431.46 g/mol. Its IUPAC name is 3-[(3R)-3-(cyclopropen-1-yl)-4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]-1-cyclopropyl-5,6,7,8-tetrahydro-2,7-naphthyridine-4-carbonitrile.
| Compound Name | 3-[(3R)-3-(cyclopropen-1-yl)-4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]-1-cyclopropyl-5,6,7,8-tetrahydro-2,7-naphthyridine-4-carbonitrile |
|---|---|
| PubChem CID | 130272521 |
| Molecular Formula | C22H24F3N5O |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 3-[(3R)-3-(cyclopropen-1-yl)-4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]-1-cyclopropyl-5,6,7,8-tetrahydro-2,7-naphthyridine-4-carbonitrile |
| SMILES | N#Cc1c(N2CCN(C(=O)CC(F)(F)F)[C@H](C3=CC3)C2)nc(C2CC2)c2c1CCNC2 |
| InChI | InChI=1S/C22H24F3N5O/c23-22(24,25)9-19(31)30-8-7-29(12-18(30)13-1-2-13)21-16(10-26)15-5-6-27-11-17(15)20(28-21)14-3-4-14/h1,14,18,27H,2-9,11-12H2/t18-/m0/s1 |
| InChIKey | VTTZLBQWDPXUDV-SFHVURJKSA-N |
| XLogP | 2.78 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|