C7H8F10N2O — CID 130272743
2-[[3-[bis(trifluoromethyl)amino]-2,2,3,3-tetrafluoropropyl]amino]ethanol (PubChem CID 130272743) has the molecular formula C7H8F10N2O and a molecular weight of 326.13 g/mol. Its IUPAC name is 2-[[3-[bis(trifluoromethyl)amino]-2,2,3,3-tetrafluoropropyl]amino]ethanol.
| Compound Name | 2-[[3-[bis(trifluoromethyl)amino]-2,2,3,3-tetrafluoropropyl]amino]ethanol |
|---|---|
| PubChem CID | 130272743 |
| Molecular Formula | C7H8F10N2O |
| Molecular Weight | 326.13 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-[[3-[bis(trifluoromethyl)amino]-2,2,3,3-tetrafluoropropyl]amino]ethanol |
| SMILES | OCCNCC(F)(F)C(F)(F)N(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F10N2O/c8-4(9,3-18-1-2-20)5(10,11)19(6(12,13)14)7(15,16)17/h18,20H,1-3H2 |
| InChIKey | LDCCBHIOLBSBFK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.13 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|