C13H8F18N2O5S — CID 130273469
2-[[2-[difluoro-[2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)morpholin-4-yl]methyl]-2,3,3,3-tetrafluoropropanoyl]-methylamino]ethanesulfonic acid (PubChem CID 130273469) has the molecular formula C13H8F18N2O5S and a molecular weight of 646.25 g/mol. Its IUPAC name is 2-[[2-[difluoro-[2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)morpholin-4-yl]methyl]-2,3,3,3-tetrafluoropropanoyl]-methylamino]ethanesulfonic acid.
| Compound Name | 2-[[2-[difluoro-[2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)morpholin-4-yl]methyl]-2,3,3,3-tetrafluoropropanoyl]-methylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 130273469 |
| Molecular Formula | C13H8F18N2O5S |
| Molecular Weight | 646.25 g/mol |
| Exact Mass | 645.99 |
| IUPAC Name | 2-[[2-[difluoro-[2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)morpholin-4-yl]methyl]-2,3,3,3-tetrafluoropropanoyl]-methylamino]ethanesulfonic acid |
| SMILES | CN(CCS(=O)(=O)O)C(=O)C(F)(C(F)(F)F)C(F)(F)N1C(F)(F)C(F)(C(F)(F)F)OC(F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C13H8F18N2O5S/c1-32(2-3-39(35,36)37)4(34)5(14,8(17,18)19)11(26,27)33-12(28,29)6(15,9(20,21)22)38-7(16,10(23,24)25)13(33,30)31/h2-3H2,1H3,(H,35,36,37) |
| InChIKey | YBQWUNJDDGJDKD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.25 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|