C15H16IN3O — CID 130273685
(Z)-1-(4-iodophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one (PubChem CID 130273685) has the molecular formula C15H16IN3O and a molecular weight of 381.22 g/mol. Its IUPAC name is (Z)-1-(4-iodophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one.
| Compound Name | (Z)-1-(4-iodophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 130273685 |
| Molecular Formula | C15H16IN3O |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | (Z)-1-(4-iodophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-one |
| SMILES | CC(C)(C)C(=O)/C(=C/c1ccc(I)cc1)n1cncn1 |
| InChI | InChI=1S/C15H16IN3O/c1-15(2,3)14(20)13(19-10-17-9-18-19)8-11-4-6-12(16)7-5-11/h4-10H,1-3H3/b13-8- |
| InChIKey | FAMOCMSYXPDZLX-JYRVWZFOSA-N |
| XLogP | 3.50 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|