C47H33FN6O3 — CID 130273776
(2Z,4Z)-2-[5-(4-fluorophenyl)-1H-indol-3-yl]-3,4-dipyridin-3-yl-5-[5-(3,4,5-trimethoxyphenyl)-1H-indol-3-yl]hexa-2,4-dienedinitrile (PubChem CID 130273776) has the molecular formula C47H33FN6O3 and a molecular weight of 748.82 g/mol. Its IUPAC name is (2Z,4Z)-2-[5-(4-fluorophenyl)-1H-indol-3-yl]-3,4-dipyridin-3-yl-5-[5-(3,4,5-trimethoxyphenyl)-1H-indol-3-yl]hexa-2,4-dienedinitrile.
| Compound Name | (2Z,4Z)-2-[5-(4-fluorophenyl)-1H-indol-3-yl]-3,4-dipyridin-3-yl-5-[5-(3,4,5-trimethoxyphenyl)-1H-indol-3-yl]hexa-2,4-dienedinitrile |
|---|---|
| PubChem CID | 130273776 |
| Molecular Formula | C47H33FN6O3 |
| Molecular Weight | 748.82 g/mol |
| Exact Mass | 748.26 |
| IUPAC Name | (2Z,4Z)-2-[5-(4-fluorophenyl)-1H-indol-3-yl]-3,4-dipyridin-3-yl-5-[5-(3,4,5-trimethoxyphenyl)-1H-indol-3-yl]hexa-2,4-dienedinitrile |
| SMILES | COc1cc(-c2ccc3[nH]cc(/C(C#N)=C(C(=C(\C#N)c4c[nH]c5ccc(-c6ccc(F)cc6)cc45)\c4cccnc4)/c4cccnc4)c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C47H33FN6O3/c1-55-43-20-33(21-44(56-2)47(43)57-3)30-11-15-42-36(19-30)40(27-54-42)38(23-50)46(32-7-5-17-52-25-32)45(31-6-4-16-51-24-31)37(22-49)39-26-53-41-14-10-29(18-35(39)41)28-8-12-34(48)13-9-28/h4-21,24-27,53-54H,1-3H3/b45-37-,46-38- |
| InChIKey | NMJVASCRNBRRRU-IKEJWENHSA-N |
| XLogP | 10.51 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.82 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|