About N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine
N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine (PubChem CID 130275184) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine.
Molecular Properties
| Compound Name | N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine |
| PubChem CID | 130275184 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine |
| SMILES | C=CC1=C(/N=C/C)C(/N=C/C)=C(C=C)C1 |
| InChI | InChI=1S/C13H16N2/c1-5-10-9-11(6-2)13(15-8-4)12(10)14-7-3/h5-8H,1-2,9H2,3-4H3/b14-7+,15-8+ |
| InChIKey | QQYNOYDKXVKYLX-IROCBMIISA-N |
| XLogP | 3.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine?
The IUPAC name of N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine (CID 130275184) is N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine.
What is the SMILES notation for N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine?
The canonical SMILES for N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine is C=CC1=C(/N=C/C)C(/N=C/C)=C(C=C)C1.
What is the InChIKey of N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine?
The InChIKey is QQYNOYDKXVKYLX-IROCBMIISA-N. The full InChI is InChI=1S/C13H16N2/c1-5-10-9-11(6-2)13(15-8-4)12(10)14-7-3/h5-8H,1-2,9H2,3-4H3/b14-7+,15-8+.
What are the key properties of N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine?
N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine has a molecular weight of 200.28 g/mol, XLogP of 3.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,4-bis(ethenyl)-5-(ethylideneamino)cyclopenta-1,4-dien-1-yl]ethanimine is sourced from PubChem (CID 130275184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).