C24H23F3O7S — CID 130275802
3-cyclopropyl-3-[2-[3-formyl-4-(trifluoromethylsulfonyloxy)phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoic acid (PubChem CID 130275802) has the molecular formula C24H23F3O7S and a molecular weight of 512.50 g/mol. Its IUPAC name is 3-cyclopropyl-3-[2-[3-formyl-4-(trifluoromethylsulfonyloxy)phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoic acid.
| Compound Name | 3-cyclopropyl-3-[2-[3-formyl-4-(trifluoromethylsulfonyloxy)phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 130275802 |
| Molecular Formula | C24H23F3O7S |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 3-cyclopropyl-3-[2-[3-formyl-4-(trifluoromethylsulfonyloxy)phenyl]-3,4-dihydro-2H-chromen-7-yl]-2-methylpropanoic acid |
| SMILES | CC(C(=O)O)C(c1ccc2c(c1)OC(c1ccc(OS(=O)(=O)C(F)(F)F)c(C=O)c1)CC2)C1CC1 |
| InChI | InChI=1S/C24H23F3O7S/c1-13(23(29)30)22(15-3-4-15)17-5-2-14-6-8-19(33-21(14)11-17)16-7-9-20(18(10-16)12-28)34-35(31,32)24(25,26)27/h2,5,7,9-13,15,19,22H,3-4,6,8H2,1H3,(H,29,30) |
| InChIKey | TTXYGZSAXYFNRJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|