About 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine
2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine (PubChem CID 130276589) has the molecular formula C11H23FN2
and a molecular weight of 202.32 g/mol. Its IUPAC name is 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine.
Molecular Properties
| Compound Name | 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine |
| PubChem CID | 130276589 |
| Molecular Formula | C11H23FN2 |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.18 |
| IUPAC Name | 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine |
| SMILES | C=C(CCCCCCC)NC(N)CF |
| InChI | InChI=1S/C11H23FN2/c1-3-4-5-6-7-8-10(2)14-11(13)9-12/h11,14H,2-9,13H2,1H3 |
| InChIKey | NBLAPQRPYSEQSM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine?
The IUPAC name of 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine (CID 130276589) is 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine.
What is the SMILES notation for 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine?
The canonical SMILES for 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine is C=C(CCCCCCC)NC(N)CF.
What is the InChIKey of 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine?
The InChIKey is NBLAPQRPYSEQSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23FN2/c1-3-4-5-6-7-8-10(2)14-11(13)9-12/h11,14H,2-9,13H2,1H3.
What are the key properties of 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine?
2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine has a molecular weight of 202.32 g/mol, XLogP of 2.70, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1-N'-non-1-en-2-ylethane-1,1-diamine is sourced from PubChem (CID 130276589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).