C18H16N2O6S — CID 130276782
2-amino-7-(1,1-dioxothian-4-yl)-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid (PubChem CID 130276782) has the molecular formula C18H16N2O6S and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-amino-7-(1,1-dioxothian-4-yl)-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid.
| Compound Name | 2-amino-7-(1,1-dioxothian-4-yl)-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 130276782 |
| Molecular Formula | C18H16N2O6S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-amino-7-(1,1-dioxothian-4-yl)-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid |
| SMILES | Nc1nc2oc3ccc(C4CCS(=O)(=O)CC4)cc3c(=O)c2cc1C(=O)O |
| InChI | InChI=1S/C18H16N2O6S/c19-16-13(18(22)23)8-12-15(21)11-7-10(1-2-14(11)26-17(12)20-16)9-3-5-27(24,25)6-4-9/h1-2,7-9H,3-6H2,(H2,19,20)(H,22,23) |
| InChIKey | YLXHHSZCWBYDQH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 140.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|